C10H14ClF2N3O — CID 104632823
1-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-4-methylcyclohexan-1-amine (PubChem CID 104632823) has the molecular formula C10H14ClF2N3O and a molecular weight of 265.69 g/mol. Its IUPAC name is 1-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-4-methylcyclohexan-1-amine.
| Compound Name | 1-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-4-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 104632823 |
| Molecular Formula | C10H14ClF2N3O |
| Molecular Weight | 265.69 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 1-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-4-methylcyclohexan-1-amine |
| SMILES | CC1CCC(N)(c2noc(C(F)(F)Cl)n2)CC1 |
| InChI | InChI=1S/C10H14ClF2N3O/c1-6-2-4-9(14,5-3-6)7-15-8(17-16-7)10(11,12)13/h6H,2-5,14H2,1H3 |
| InChIKey | UMVYEACLZIDVFO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|