C10H10ClN3O2 — CID 104633256
2-amino-2-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 104633256) has the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. Its IUPAC name is 2-amino-2-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 2-amino-2-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 104633256 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 2-amino-2-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | NC(CO)c1noc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C10H10ClN3O2/c11-7-3-1-6(2-4-7)10-13-9(14-16-10)8(12)5-15/h1-4,8,15H,5,12H2 |
| InChIKey | DDHXROMVFIEQDF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |