C12H13ClN2O2 — CID 113443207
1-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]butan-1-ol (PubChem CID 113443207) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]butan-1-ol.
| Compound Name | 1-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]butan-1-ol |
|---|---|
| PubChem CID | 113443207 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]butan-1-ol |
| SMILES | CCCC(O)c1noc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C12H13ClN2O2/c1-2-3-10(16)11-14-12(17-15-11)8-4-6-9(13)7-5-8/h4-7,10,16H,2-3H2,1H3 |
| InChIKey | JCRVDTROXBYTCV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |