C15H23N3O2 — CID 104633299
2-amino-2-[5-(3-methyl-1-adamantyl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 104633299) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-amino-2-[5-(3-methyl-1-adamantyl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 2-amino-2-[5-(3-methyl-1-adamantyl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 104633299 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 2-amino-2-[5-(3-methyl-1-adamantyl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | CC12CC3CC(C1)CC(c1nc(C(N)CO)no1)(C3)C2 |
| InChI | InChI=1S/C15H23N3O2/c1-14-3-9-2-10(4-14)6-15(5-9,8-14)13-17-12(18-20-13)11(16)7-19/h9-11,19H,2-8,16H2,1H3 |
| InChIKey | ZOOBWRXLCJWZNM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |