C11H12N4O5 — CID 104633484
2-amino-2-[5-(2-methoxy-3-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 104633484) has the molecular formula C11H12N4O5 and a molecular weight of 280.24 g/mol. Its IUPAC name is 2-amino-2-[5-(2-methoxy-3-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 2-amino-2-[5-(2-methoxy-3-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 104633484 |
| Molecular Formula | C11H12N4O5 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-amino-2-[5-(2-methoxy-3-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | COc1c(-c2nc(C(N)CO)no2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N4O5/c1-19-9-6(3-2-4-8(9)15(17)18)11-13-10(14-20-11)7(12)5-16/h2-4,7,16H,5,12H2,1H3 |
| InChIKey | AORYATUCBXMUDH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|