C11H10F2N4O4 — CID 104633586
1-[5-(4,5-difluoro-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]-2-methoxyethanamine (PubChem CID 104633586) has the molecular formula C11H10F2N4O4 and a molecular weight of 300.22 g/mol. Its IUPAC name is 1-[5-(4,5-difluoro-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]-2-methoxyethanamine.
| Compound Name | 1-[5-(4,5-difluoro-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 104633586 |
| Molecular Formula | C11H10F2N4O4 |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-[5-(4,5-difluoro-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]-2-methoxyethanamine |
| SMILES | COCC(N)c1noc(-c2cc(F)c(F)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H10F2N4O4/c1-20-4-8(14)10-15-11(21-16-10)5-2-6(12)7(13)3-9(5)17(18)19/h2-3,8H,4,14H2,1H3 |
| InChIKey | LDDJIXWBWXOIBQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|