C14H19N3O2 — CID 104634245
1-(5-benzyl-1,2,4-oxadiazol-3-yl)-2-propoxyethanamine (PubChem CID 104634245) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-(5-benzyl-1,2,4-oxadiazol-3-yl)-2-propoxyethanamine.
| Compound Name | 1-(5-benzyl-1,2,4-oxadiazol-3-yl)-2-propoxyethanamine |
|---|---|
| PubChem CID | 104634245 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-(5-benzyl-1,2,4-oxadiazol-3-yl)-2-propoxyethanamine |
| SMILES | CCCOCC(N)c1noc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H19N3O2/c1-2-8-18-10-12(15)14-16-13(19-17-14)9-11-6-4-3-5-7-11/h3-7,12H,2,8-10,15H2,1H3 |
| InChIKey | HQTZSFYXTYZTGD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|