C11H13N3O — CID 61326226
1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 61326226) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethanamine.
| Compound Name | 1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 61326226 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | CC(N)c1noc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C11H13N3O/c1-8(12)11-13-10(15-14-11)7-9-5-3-2-4-6-9/h2-6,8H,7,12H2,1H3 |
| InChIKey | CHEZCXNPSVEFKN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |