C10H12IN3O2S — CID 104636361
2-[5-(5-iodothiophen-3-yl)-1,2,4-oxadiazol-3-yl]-1-methoxypropan-2-amine (PubChem CID 104636361) has the molecular formula C10H12IN3O2S and a molecular weight of 365.20 g/mol. Its IUPAC name is 2-[5-(5-iodothiophen-3-yl)-1,2,4-oxadiazol-3-yl]-1-methoxypropan-2-amine.
| Compound Name | 2-[5-(5-iodothiophen-3-yl)-1,2,4-oxadiazol-3-yl]-1-methoxypropan-2-amine |
|---|---|
| PubChem CID | 104636361 |
| Molecular Formula | C10H12IN3O2S |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | 2-[5-(5-iodothiophen-3-yl)-1,2,4-oxadiazol-3-yl]-1-methoxypropan-2-amine |
| SMILES | COCC(C)(N)c1noc(-c2csc(I)c2)n1 |
| InChI | InChI=1S/C10H12IN3O2S/c1-10(12,5-15-2)9-13-8(16-14-9)6-3-7(11)17-4-6/h3-4H,5,12H2,1-2H3 |
| InChIKey | KMXYRYHYVTXCAW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|