C12H13FN4O4 — CID 104636511
2-[5-(3-fluoro-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]-1-methoxypropan-2-amine (PubChem CID 104636511) has the molecular formula C12H13FN4O4 and a molecular weight of 296.26 g/mol. Its IUPAC name is 2-[5-(3-fluoro-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]-1-methoxypropan-2-amine.
| Compound Name | 2-[5-(3-fluoro-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]-1-methoxypropan-2-amine |
|---|---|
| PubChem CID | 104636511 |
| Molecular Formula | C12H13FN4O4 |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-[5-(3-fluoro-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]-1-methoxypropan-2-amine |
| SMILES | COCC(C)(N)c1noc(-c2cc(F)cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C12H13FN4O4/c1-12(14,6-20-2)11-15-10(21-16-11)7-3-8(13)5-9(4-7)17(18)19/h3-5H,6,14H2,1-2H3 |
| InChIKey | ZZZHDJORIFBWHH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|