C13H17FN4O2 — CID 104786458
2-[5-(5-fluoro-3-pyridinyl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine (PubChem CID 104786458) has the molecular formula C13H17FN4O2 and a molecular weight of 280.30 g/mol. Its IUPAC name is 2-[5-(5-fluoro-3-pyridinyl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine.
| Compound Name | 2-[5-(5-fluoro-3-pyridinyl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine |
|---|---|
| PubChem CID | 104786458 |
| Molecular Formula | C13H17FN4O2 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-[5-(5-fluoro-3-pyridinyl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine |
| SMILES | CCCOCC(C)(N)c1noc(-c2cncc(F)c2)n1 |
| InChI | InChI=1S/C13H17FN4O2/c1-3-4-19-8-13(2,15)12-17-11(20-18-12)9-5-10(14)7-16-6-9/h5-7H,3-4,8,15H2,1-2H3 |
| InChIKey | HNXHQIWNVMRQOF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|