C14H17Br2N3O2 — CID 107940756
2-[5-(2,4-dibromophenyl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine (PubChem CID 107940756) has the molecular formula C14H17Br2N3O2 and a molecular weight of 419.12 g/mol. Its IUPAC name is 2-[5-(2,4-dibromophenyl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine.
| Compound Name | 2-[5-(2,4-dibromophenyl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine |
|---|---|
| PubChem CID | 107940756 |
| Molecular Formula | C14H17Br2N3O2 |
| Molecular Weight | 419.12 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | 2-[5-(2,4-dibromophenyl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine |
| SMILES | CCCOCC(C)(N)c1noc(-c2ccc(Br)cc2Br)n1 |
| InChI | InChI=1S/C14H17Br2N3O2/c1-3-6-20-8-14(2,17)13-18-12(21-19-13)10-5-4-9(15)7-11(10)16/h4-5,7H,3,6,8,17H2,1-2H3 |
| InChIKey | LNCSKZWILWIDOP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.12 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|