C12H16ClN3O3 — CID 106689504
2-[5-(2-chlorofuran-3-yl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine (PubChem CID 106689504) has the molecular formula C12H16ClN3O3 and a molecular weight of 285.73 g/mol. Its IUPAC name is 2-[5-(2-chlorofuran-3-yl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine.
| Compound Name | 2-[5-(2-chlorofuran-3-yl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine |
|---|---|
| PubChem CID | 106689504 |
| Molecular Formula | C12H16ClN3O3 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-[5-(2-chlorofuran-3-yl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine |
| SMILES | CCCOCC(C)(N)c1noc(-c2ccoc2Cl)n1 |
| InChI | InChI=1S/C12H16ClN3O3/c1-3-5-17-7-12(2,14)11-15-10(19-16-11)8-4-6-18-9(8)13/h4,6H,3,5,7,14H2,1-2H3 |
| InChIKey | WSJRKSYSJDFCFB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|