C16H26N4O — CID 104643035
5-hydrazinyl-N-(3,3,5,5-tetramethylcyclohexyl)pyridine-2-carboxamide (PubChem CID 104643035) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 5-hydrazinyl-N-(3,3,5,5-tetramethylcyclohexyl)pyridine-2-carboxamide.
| Compound Name | 5-hydrazinyl-N-(3,3,5,5-tetramethylcyclohexyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104643035 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 5-hydrazinyl-N-(3,3,5,5-tetramethylcyclohexyl)pyridine-2-carboxamide |
| SMILES | CC1(C)CC(NC(=O)c2ccc(NN)cn2)CC(C)(C)C1 |
| InChI | InChI=1S/C16H26N4O/c1-15(2)7-12(8-16(3,4)10-15)19-14(21)13-6-5-11(20-17)9-18-13/h5-6,9,12,20H,7-8,10,17H2,1-4H3,(H,19,21) |
| InChIKey | SETVYODMYSXSTG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|