C15H24N4O — CID 103968311
6-amino-N-(3,3,5,5-tetramethylcyclohexyl)pyridazine-3-carboxamide (PubChem CID 103968311) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 6-amino-N-(3,3,5,5-tetramethylcyclohexyl)pyridazine-3-carboxamide.
| Compound Name | 6-amino-N-(3,3,5,5-tetramethylcyclohexyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103968311 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 6-amino-N-(3,3,5,5-tetramethylcyclohexyl)pyridazine-3-carboxamide |
| SMILES | CC1(C)CC(NC(=O)c2ccc(N)nn2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H24N4O/c1-14(2)7-10(8-15(3,4)9-14)17-13(20)11-5-6-12(16)19-18-11/h5-6,10H,7-9H2,1-4H3,(H2,16,19)(H,17,20) |
| InChIKey | XVGIQLDGRIDIER-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |