C9H13N5O2 — CID 62154293
N-(2-acetamidoethyl)-6-aminopyridazine-3-carboxamide (PubChem CID 62154293) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-6-aminopyridazine-3-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-6-aminopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62154293 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | N-(2-acetamidoethyl)-6-aminopyridazine-3-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1ccc(N)nn1 |
| InChI | InChI=1S/C9H13N5O2/c1-6(15)11-4-5-12-9(16)7-2-3-8(10)14-13-7/h2-3H,4-5H2,1H3,(H2,10,14)(H,11,15)(H,12,16) |
| InChIKey | HPEJYZYPTFEYAL-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|