C8H13N5O2 — CID 110691590
N-(2-acetamidoethyl)-1-methyltriazole-4-carboxamide (PubChem CID 110691590) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-1-methyltriazole-4-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-1-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 110691590 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N-(2-acetamidoethyl)-1-methyltriazole-4-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1cn(C)nn1 |
| InChI | InChI=1S/C8H13N5O2/c1-6(14)9-3-4-10-8(15)7-5-13(2)12-11-7/h5H,3-4H2,1-2H3,(H,9,14)(H,10,15) |
| InChIKey | GWYIUNOVOFPCDR-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|