C13H16N4OS — CID 110482116
1-methyl-N-[2-(2-methylsulfanylphenyl)ethyl]triazole-4-carboxamide (PubChem CID 110482116) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 1-methyl-N-[2-(2-methylsulfanylphenyl)ethyl]triazole-4-carboxamide.
| Compound Name | 1-methyl-N-[2-(2-methylsulfanylphenyl)ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 110482116 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-methyl-N-[2-(2-methylsulfanylphenyl)ethyl]triazole-4-carboxamide |
| SMILES | CSc1ccccc1CCNC(=O)c1cn(C)nn1 |
| InChI | InChI=1S/C13H16N4OS/c1-17-9-11(15-16-17)13(18)14-8-7-10-5-3-4-6-12(10)19-2/h3-6,9H,7-8H2,1-2H3,(H,14,18) |
| InChIKey | QBJYPJPSNWQTBB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |