C10H17BrN4O — CID 164663050
N-(4-bromo-3,3-dimethylbutyl)-1-methyltriazole-4-carboxamide (PubChem CID 164663050) has the molecular formula C10H17BrN4O and a molecular weight of 289.18 g/mol. Its IUPAC name is N-(4-bromo-3,3-dimethylbutyl)-1-methyltriazole-4-carboxamide.
| Compound Name | N-(4-bromo-3,3-dimethylbutyl)-1-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 164663050 |
| Molecular Formula | C10H17BrN4O |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-(4-bromo-3,3-dimethylbutyl)-1-methyltriazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NCCC(C)(C)CBr)nn1 |
| InChI | InChI=1S/C10H17BrN4O/c1-10(2,7-11)4-5-12-9(16)8-6-15(3)14-13-8/h6H,4-5,7H2,1-3H3,(H,12,16) |
| InChIKey | SANIEVIUHRRCAI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|