C11H23NO4 — CID 104644556
methyl 2-hydroxy-3-(1-methoxypentan-2-ylamino)-2-methylpropanoate (PubChem CID 104644556) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is methyl 2-hydroxy-3-(1-methoxypentan-2-ylamino)-2-methylpropanoate.
| Compound Name | methyl 2-hydroxy-3-(1-methoxypentan-2-ylamino)-2-methylpropanoate |
|---|---|
| PubChem CID | 104644556 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | methyl 2-hydroxy-3-(1-methoxypentan-2-ylamino)-2-methylpropanoate |
| SMILES | CCCC(COC)NCC(C)(O)C(=O)OC |
| InChI | InChI=1S/C11H23NO4/c1-5-6-9(7-15-3)12-8-11(2,14)10(13)16-4/h9,12,14H,5-8H2,1-4H3 |
| InChIKey | ZPOKNSDCSXOWLJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |