C14H22N2O4 — CID 104647008
N-[[3-(4-methoxybutoxy)-4-nitrophenyl]methyl]ethanamine (PubChem CID 104647008) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-[[3-(4-methoxybutoxy)-4-nitrophenyl]methyl]ethanamine.
| Compound Name | N-[[3-(4-methoxybutoxy)-4-nitrophenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 104647008 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-[[3-(4-methoxybutoxy)-4-nitrophenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc([N+](=O)[O-])c(OCCCCOC)c1 |
| InChI | InChI=1S/C14H22N2O4/c1-3-15-11-12-6-7-13(16(17)18)14(10-12)20-9-5-4-8-19-2/h6-7,10,15H,3-5,8-9,11H2,1-2H3 |
| InChIKey | HEUXFJCYHYEULB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|