C12H18N2O5 — CID 63060105
2-[5-[(2-methoxyethylamino)methyl]-2-nitrophenoxy]ethanol (PubChem CID 63060105) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-[5-[(2-methoxyethylamino)methyl]-2-nitrophenoxy]ethanol.
| Compound Name | 2-[5-[(2-methoxyethylamino)methyl]-2-nitrophenoxy]ethanol |
|---|---|
| PubChem CID | 63060105 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[5-[(2-methoxyethylamino)methyl]-2-nitrophenoxy]ethanol |
| SMILES | COCCNCc1ccc([N+](=O)[O-])c(OCCO)c1 |
| InChI | InChI=1S/C12H18N2O5/c1-18-6-4-13-9-10-2-3-11(14(16)17)12(8-10)19-7-5-15/h2-3,8,13,15H,4-7,9H2,1H3 |
| InChIKey | PRSHWUBHTZRRFP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|