C10H18O2 — CID 10464738
(1S,3R,4S)-2,2-dimethyl-4-prop-1-en-2-ylcyclopentane-1,3-diol (PubChem CID 10464738) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (1S,3R,4S)-2,2-dimethyl-4-prop-1-en-2-ylcyclopentane-1,3-diol.
| Compound Name | (1S,3R,4S)-2,2-dimethyl-4-prop-1-en-2-ylcyclopentane-1,3-diol |
|---|---|
| PubChem CID | 10464738 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (1S,3R,4S)-2,2-dimethyl-4-prop-1-en-2-ylcyclopentane-1,3-diol |
| SMILES | C=C(C)[C@@H]1C[C@H](O)C(C)(C)[C@@H]1O |
| InChI | InChI=1S/C10H18O2/c1-6(2)7-5-8(11)10(3,4)9(7)12/h7-9,11-12H,1,5H2,2-4H3/t7-,8-,9+/m0/s1 |
| InChIKey | FQVIPBCTNBRSQH-XHNCKOQMSA-N |
| XLogP | 1.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|