About 2-methylsulfanylimidazo[1,5-a][1,3,5]triazin-4-amine
2-methylsulfanylimidazo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 10464931) has the molecular formula C6H7N5S
and a molecular weight of 181.22 g/mol. Its IUPAC name is 2-methylsulfanylimidazo[1,5-a][1,3,5]triazin-4-amine.
Analyze 2-methylsulfanylimidazo[1,5-a][1,3,5]triazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylimidazo[1,5-a][1,3,5]triazin-4-amine?
The IUPAC name of 2-methylsulfanylimidazo[1,5-a][1,3,5]triazin-4-amine (CID 10464931) is 2-methylsulfanylimidazo[1,5-a][1,3,5]triazin-4-amine.
What is the SMILES notation for 2-methylsulfanylimidazo[1,5-a][1,3,5]triazin-4-amine?
The canonical SMILES for 2-methylsulfanylimidazo[1,5-a][1,3,5]triazin-4-amine is CSc1nc(N)n2cncc2n1.
What is the InChIKey of 2-methylsulfanylimidazo[1,5-a][1,3,5]triazin-4-amine?
The InChIKey is UQMHDPXSVZAAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5S/c1-12-6-9-4-2-8-3-11(4)5(7)10-6/h2-3H,1H3,(H2,7,9,10).
What are the key properties of 2-methylsulfanylimidazo[1,5-a][1,3,5]triazin-4-amine?
2-methylsulfanylimidazo[1,5-a][1,3,5]triazin-4-amine has a molecular weight of 181.22 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylimidazo[1,5-a][1,3,5]triazin-4-amine is sourced from PubChem (CID 10464931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).