C10H5Cl2FN4S — CID 166138861
7,13-dichloro-8-fluoro-11-methylsulfanyl-4,6,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene (PubChem CID 166138861) has the molecular formula C10H5Cl2FN4S and a molecular weight of 303.15 g/mol. Its IUPAC name is 7,13-dichloro-8-fluoro-11-methylsulfanyl-4,6,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene.
| Compound Name | 7,13-dichloro-8-fluoro-11-methylsulfanyl-4,6,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
|---|---|
| PubChem CID | 166138861 |
| Molecular Formula | C10H5Cl2FN4S |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | 7,13-dichloro-8-fluoro-11-methylsulfanyl-4,6,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
| SMILES | CSc1nc(Cl)c2c(n1)c(F)c(Cl)n1cncc21 |
| InChI | InChI=1S/C10H5Cl2FN4S/c1-18-10-15-7-5(8(11)16-10)4-2-14-3-17(4)9(12)6(7)13/h2-3H,1H3 |
| InChIKey | QYJQOJWXYWKEHZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|