C8H3Cl3FN3S — CID 168876777
4,5,7-trichloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidine (PubChem CID 168876777) has the molecular formula C8H3Cl3FN3S and a molecular weight of 298.56 g/mol. Its IUPAC name is 4,5,7-trichloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidine.
| Compound Name | 4,5,7-trichloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 168876777 |
| Molecular Formula | C8H3Cl3FN3S |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 296.91 |
| IUPAC Name | 4,5,7-trichloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidine |
| SMILES | CSc1nc(Cl)c2c(Cl)nc(Cl)c(F)c2n1 |
| InChI | InChI=1S/C8H3Cl3FN3S/c1-16-8-13-4-2(6(10)15-8)5(9)14-7(11)3(4)12/h1H3 |
| InChIKey | PWYGKNIMUAMHIS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|