C15H18ClFN4OS — CID 175975998
7-chloro-8-fluoro-5-methoxy-4-[(3R)-3-methylpiperidin-1-yl]-2-methylsulfanylpyrido[4,3-d]pyrimidine (PubChem CID 175975998) has the molecular formula C15H18ClFN4OS and a molecular weight of 356.85 g/mol. Its IUPAC name is 7-chloro-8-fluoro-5-methoxy-4-[(3R)-3-methylpiperidin-1-yl]-2-methylsulfanylpyrido[4,3-d]pyrimidine.
| Compound Name | 7-chloro-8-fluoro-5-methoxy-4-[(3R)-3-methylpiperidin-1-yl]-2-methylsulfanylpyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 175975998 |
| Molecular Formula | C15H18ClFN4OS |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 7-chloro-8-fluoro-5-methoxy-4-[(3R)-3-methylpiperidin-1-yl]-2-methylsulfanylpyrido[4,3-d]pyrimidine |
| SMILES | COc1nc(Cl)c(F)c2nc(SC)nc(N3CCC[C@@H](C)C3)c12 |
| InChI | InChI=1S/C15H18ClFN4OS/c1-8-5-4-6-21(7-8)13-9-11(18-15(20-13)23-3)10(17)12(16)19-14(9)22-2/h8H,4-7H2,1-3H3/t8-/m1/s1 |
| InChIKey | MFCSSXSZARPPBP-MRVPVSSYSA-N |
| XLogP | 3.78 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|