C16H22ClFN4 — CID 176951731
7-chloro-2-fluoro-8-methyl-4-(3-methylazepan-1-yl)pyrido[4,3-d]pyrimidine;methane (PubChem CID 176951731) has the molecular formula C16H22ClFN4 and a molecular weight of 324.83 g/mol. Its IUPAC name is 7-chloro-2-fluoro-8-methyl-4-(3-methylazepan-1-yl)pyrido[4,3-d]pyrimidine;methane.
| Compound Name | 7-chloro-2-fluoro-8-methyl-4-(3-methylazepan-1-yl)pyrido[4,3-d]pyrimidine;methane |
|---|---|
| PubChem CID | 176951731 |
| Molecular Formula | C16H22ClFN4 |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 7-chloro-2-fluoro-8-methyl-4-(3-methylazepan-1-yl)pyrido[4,3-d]pyrimidine;methane |
| SMILES | C.Cc1c(Cl)ncc2c(N3CCCCC(C)C3)nc(F)nc12 |
| InChI | InChI=1S/C15H18ClFN4.CH4/c1-9-5-3-4-6-21(8-9)14-11-7-18-13(16)10(2)12(11)19-15(17)20-14;/h7,9H,3-6,8H2,1-2H3;1H4 |
| InChIKey | BKQBSLLXGJFTIN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|