C10H10ClFN4OS — CID 176974340
7-chloro-4-(ethylamino)-8-fluoro-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 176974340) has the molecular formula C10H10ClFN4OS and a molecular weight of 288.74 g/mol. Its IUPAC name is 7-chloro-4-(ethylamino)-8-fluoro-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 7-chloro-4-(ethylamino)-8-fluoro-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 176974340 |
| Molecular Formula | C10H10ClFN4OS |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 7-chloro-4-(ethylamino)-8-fluoro-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCNc1nc(SC)nc2c(F)c(Cl)[nH]c(=O)c12 |
| InChI | InChI=1S/C10H10ClFN4OS/c1-3-13-8-4-6(14-10(16-8)18-2)5(12)7(11)15-9(4)17/h3H2,1-2H3,(H,15,17)(H,13,14,16) |
| InChIKey | VNBKEMSZRWZSHV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|