C10H7ClF4N4OS — CID 176974607
7-chloro-8-fluoro-2-methylsulfanyl-4-(2,2,2-trifluoroethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 176974607) has the molecular formula C10H7ClF4N4OS and a molecular weight of 342.71 g/mol. Its IUPAC name is 7-chloro-8-fluoro-2-methylsulfanyl-4-(2,2,2-trifluoroethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 7-chloro-8-fluoro-2-methylsulfanyl-4-(2,2,2-trifluoroethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 176974607 |
| Molecular Formula | C10H7ClF4N4OS |
| Molecular Weight | 342.71 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 7-chloro-8-fluoro-2-methylsulfanyl-4-(2,2,2-trifluoroethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CSc1nc(NCC(F)(F)F)c2c(=O)[nH]c(Cl)c(F)c2n1 |
| InChI | InChI=1S/C10H7ClF4N4OS/c1-21-9-17-5-3(8(20)18-6(11)4(5)12)7(19-9)16-2-10(13,14)15/h2H2,1H3,(H,18,20)(H,16,17,19) |
| InChIKey | TVAIDQWXYWDLCU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.71 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|