C6H6Cl2N2OS — CID 15003627
4,6-dichloro-5-methoxy-2-methylsulfanylpyrimidine (PubChem CID 15003627) has the molecular formula C6H6Cl2N2OS and a molecular weight of 225.10 g/mol. Its IUPAC name is 4,6-dichloro-5-methoxy-2-methylsulfanylpyrimidine.
| Compound Name | 4,6-dichloro-5-methoxy-2-methylsulfanylpyrimidine |
|---|---|
| PubChem CID | 15003627 |
| Molecular Formula | C6H6Cl2N2OS |
| Molecular Weight | 225.10 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | 4,6-dichloro-5-methoxy-2-methylsulfanylpyrimidine |
| SMILES | COc1c(Cl)nc(SC)nc1Cl |
| InChI | InChI=1S/C6H6Cl2N2OS/c1-11-3-4(7)9-6(12-2)10-5(3)8/h1-2H3 |
| InChIKey | OARJVJCNEZWMCZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.10 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |