About 4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline
4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline (PubChem CID 91119672) has the molecular formula C12H8ClN3S
and a molecular weight of 261.74 g/mol. Its IUPAC name is 4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline.
Molecular Properties
| Compound Name | 4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline |
| PubChem CID | 91119672 |
| Molecular Formula | C12H8ClN3S |
| Molecular Weight | 261.74 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline |
| SMILES | CSc1nc(Cl)c2cc3ccccc3nc2n1 |
| InChI | InChI=1S/C12H8ClN3S/c1-17-12-15-10(13)8-6-7-4-2-3-5-9(7)14-11(8)16-12/h2-6H,1H3 |
| InChIKey | GPMHNDXQCZEROO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.74 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline?
The IUPAC name of 4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline (CID 91119672) is 4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline.
What is the SMILES notation for 4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline?
The canonical SMILES for 4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline is CSc1nc(Cl)c2cc3ccccc3nc2n1.
What is the InChIKey of 4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline?
The InChIKey is GPMHNDXQCZEROO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClN3S/c1-17-12-15-10(13)8-6-7-4-2-3-5-9(7)14-11(8)16-12/h2-6H,1H3.
What are the key properties of 4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline?
4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline has a molecular weight of 261.74 g/mol, XLogP of 3.55, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methylsulfanylpyrimido[4,5-b]quinoline is sourced from PubChem (CID 91119672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).