About 1-chloro-2-ethylacridine
1-chloro-2-ethylacridine (PubChem CID 174720098) has the molecular formula C15H12ClN
and a molecular weight of 241.72 g/mol. Its IUPAC name is 1-chloro-2-ethylacridine.
Molecular Properties
| Compound Name | 1-chloro-2-ethylacridine |
| PubChem CID | 174720098 |
| Molecular Formula | C15H12ClN |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-chloro-2-ethylacridine |
| SMILES | CCc1ccc2nc3ccccc3cc2c1Cl |
| InChI | InChI=1S/C15H12ClN/c1-2-10-7-8-14-12(15(10)16)9-11-5-3-4-6-13(11)17-14/h3-9H,2H2,1H3 |
| InChIKey | NQPGYRISSIMVGM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-ethylacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-ethylacridine?
The IUPAC name of 1-chloro-2-ethylacridine (CID 174720098) is 1-chloro-2-ethylacridine.
What is the SMILES notation for 1-chloro-2-ethylacridine?
The canonical SMILES for 1-chloro-2-ethylacridine is CCc1ccc2nc3ccccc3cc2c1Cl.
What is the InChIKey of 1-chloro-2-ethylacridine?
The InChIKey is NQPGYRISSIMVGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN/c1-2-10-7-8-14-12(15(10)16)9-11-5-3-4-6-13(11)17-14/h3-9H,2H2,1H3.
What are the key properties of 1-chloro-2-ethylacridine?
1-chloro-2-ethylacridine has a molecular weight of 241.72 g/mol, XLogP of 4.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-ethylacridine is sourced from PubChem (CID 174720098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).