C9H13NO3 — CID 10464963
1,1-dimethyl-5,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-3,4-dione (PubChem CID 10464963) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 1,1-dimethyl-5,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-3,4-dione.
| Compound Name | 1,1-dimethyl-5,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-3,4-dione |
|---|---|
| PubChem CID | 10464963 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 1,1-dimethyl-5,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-3,4-dione |
| SMILES | CC1(C)OC(=O)C2C(=O)NCCC21 |
| InChI | InChI=1S/C9H13NO3/c1-9(2)5-3-4-10-7(11)6(5)8(12)13-9/h5-6H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | SAYQTOFGGIIYCK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|