C11H19NO2 — CID 116525765
3-[(5,5-dimethyloxolan-2-yl)methyl]pyrrolidin-2-one (PubChem CID 116525765) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-[(5,5-dimethyloxolan-2-yl)methyl]pyrrolidin-2-one.
| Compound Name | 3-[(5,5-dimethyloxolan-2-yl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 116525765 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 3-[(5,5-dimethyloxolan-2-yl)methyl]pyrrolidin-2-one |
| SMILES | CC1(C)CCC(CC2CCNC2=O)O1 |
| InChI | InChI=1S/C11H19NO2/c1-11(2)5-3-9(14-11)7-8-4-6-12-10(8)13/h8-9H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | VYVGXBWDGWDKGD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |