About 4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one
4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one (PubChem CID 116521902) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one.
Molecular Properties
| Compound Name | 4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one |
| PubChem CID | 116521902 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one |
| SMILES | CC1(C)CCC(COC2CCC(=O)CC2)O1 |
| InChI | InChI=1S/C13H22O3/c1-13(2)8-7-12(16-13)9-15-11-5-3-10(14)4-6-11/h11-12H,3-9H2,1-2H3 |
| InChIKey | GTDHIIPQPUBPDK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one?
The IUPAC name of 4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one (CID 116521902) is 4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one.
What is the SMILES notation for 4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one?
The canonical SMILES for 4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one is CC1(C)CCC(COC2CCC(=O)CC2)O1.
What is the InChIKey of 4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one?
The InChIKey is GTDHIIPQPUBPDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3/c1-13(2)8-7-12(16-13)9-15-11-5-3-10(14)4-6-11/h11-12H,3-9H2,1-2H3.
What are the key properties of 4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one?
4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one has a molecular weight of 226.32 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,5-dimethyloxolan-2-yl)methoxy]cyclohexan-1-one is sourced from PubChem (CID 116521902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).