C14H26ClNO2 — CID 116524057
4-(2-chloroethoxy)-1-[(5,5-dimethyloxolan-2-yl)methyl]piperidine (PubChem CID 116524057) has the molecular formula C14H26ClNO2 and a molecular weight of 275.82 g/mol. Its IUPAC name is 4-(2-chloroethoxy)-1-[(5,5-dimethyloxolan-2-yl)methyl]piperidine.
| Compound Name | 4-(2-chloroethoxy)-1-[(5,5-dimethyloxolan-2-yl)methyl]piperidine |
|---|---|
| PubChem CID | 116524057 |
| Molecular Formula | C14H26ClNO2 |
| Molecular Weight | 275.82 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 4-(2-chloroethoxy)-1-[(5,5-dimethyloxolan-2-yl)methyl]piperidine |
| SMILES | CC1(C)CCC(CN2CCC(OCCCl)CC2)O1 |
| InChI | InChI=1S/C14H26ClNO2/c1-14(2)6-3-13(18-14)11-16-8-4-12(5-9-16)17-10-7-15/h12-13H,3-11H2,1-2H3 |
| InChIKey | LHLNNXFJEULDSI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.82 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|