C16H21ClFNO2 — CID 82684841
4-(2-chloroethoxy)-1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]piperidine (PubChem CID 82684841) has the molecular formula C16H21ClFNO2 and a molecular weight of 313.80 g/mol. Its IUPAC name is 4-(2-chloroethoxy)-1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]piperidine.
| Compound Name | 4-(2-chloroethoxy)-1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]piperidine |
|---|---|
| PubChem CID | 82684841 |
| Molecular Formula | C16H21ClFNO2 |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 4-(2-chloroethoxy)-1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]piperidine |
| SMILES | Fc1ccc2c(c1)CC(CN1CCC(OCCCl)CC1)O2 |
| InChI | InChI=1S/C16H21ClFNO2/c17-5-8-20-14-3-6-19(7-4-14)11-15-10-12-9-13(18)1-2-16(12)21-15/h1-2,9,14-15H,3-8,10-11H2 |
| InChIKey | IPLFOOTUGIOLRP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|