C15H20ClFN2O — CID 66361479
1-(2-chloroethyl)-4-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]piperazine (PubChem CID 66361479) has the molecular formula C15H20ClFN2O and a molecular weight of 298.79 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]piperazine.
| Compound Name | 1-(2-chloroethyl)-4-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 66361479 |
| Molecular Formula | C15H20ClFN2O |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-(2-chloroethyl)-4-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]piperazine |
| SMILES | Fc1ccc2c(c1)CC(CN1CCN(CCCl)CC1)O2 |
| InChI | InChI=1S/C15H20ClFN2O/c16-3-4-18-5-7-19(8-6-18)11-14-10-12-9-13(17)1-2-15(12)20-14/h1-2,9,14H,3-8,10-11H2 |
| InChIKey | REQQOSPGQVELHZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|