About 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine
1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine (PubChem CID 66359956) has the molecular formula C15H21FN2O
and a molecular weight of 264.34 g/mol. Its IUPAC name is 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine |
| PubChem CID | 66359956 |
| Molecular Formula | C15H21FN2O |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine |
| SMILES | CC1(C)CN(CC2Cc3cc(F)ccc3O2)CCN1 |
| InChI | InChI=1S/C15H21FN2O/c1-15(2)10-18(6-5-17-15)9-13-8-11-7-12(16)3-4-14(11)19-13/h3-4,7,13,17H,5-6,8-10H2,1-2H3 |
| InChIKey | ZNFAFJNSMXTMSF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine?
The IUPAC name of 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine (CID 66359956) is 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine.
What is the SMILES notation for 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine?
The canonical SMILES for 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine is CC1(C)CN(CC2Cc3cc(F)ccc3O2)CCN1.
What is the InChIKey of 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine?
The InChIKey is ZNFAFJNSMXTMSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21FN2O/c1-15(2)10-18(6-5-17-15)9-13-8-11-7-12(16)3-4-14(11)19-13/h3-4,7,13,17H,5-6,8-10H2,1-2H3.
What are the key properties of 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine?
1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine has a molecular weight of 264.34 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3,3-dimethylpiperazine is sourced from PubChem (CID 66359956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).