C13H12ClFN2O — CID 106720840
4-(chloromethyl)-1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]imidazole (PubChem CID 106720840) has the molecular formula C13H12ClFN2O and a molecular weight of 266.70 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]imidazole.
| Compound Name | 4-(chloromethyl)-1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]imidazole |
|---|---|
| PubChem CID | 106720840 |
| Molecular Formula | C13H12ClFN2O |
| Molecular Weight | 266.70 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 4-(chloromethyl)-1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]imidazole |
| SMILES | Fc1ccc2c(c1)CC(Cn1cnc(CCl)c1)O2 |
| InChI | InChI=1S/C13H12ClFN2O/c14-5-11-6-17(8-16-11)7-12-4-9-3-10(15)1-2-13(9)18-12/h1-3,6,8,12H,4-5,7H2 |
| InChIKey | QYLCOMCKCQOJAR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.70 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|