C12H11BrFN3O — CID 66360503
4-(bromomethyl)-1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]triazole (PubChem CID 66360503) has the molecular formula C12H11BrFN3O and a molecular weight of 312.14 g/mol. Its IUPAC name is 4-(bromomethyl)-1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]triazole.
| Compound Name | 4-(bromomethyl)-1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]triazole |
|---|---|
| PubChem CID | 66360503 |
| Molecular Formula | C12H11BrFN3O |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 4-(bromomethyl)-1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]triazole |
| SMILES | Fc1ccc2c(c1)CC(Cn1cc(CBr)nn1)O2 |
| InChI | InChI=1S/C12H11BrFN3O/c13-5-10-6-17(16-15-10)7-11-4-8-3-9(14)1-2-12(8)18-11/h1-3,6,11H,4-5,7H2 |
| InChIKey | UPLUNHSMLNVFMO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|