About 4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine
4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine (PubChem CID 104539127) has the molecular formula C15H19BrN4O
and a molecular weight of 351.25 g/mol. Its IUPAC name is 4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine.
Molecular Properties
| Compound Name | 4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine |
| PubChem CID | 104539127 |
| Molecular Formula | C15H19BrN4O |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine |
| SMILES | NCCCCc1cn(CC2Cc3cc(Br)ccc3O2)nn1 |
| InChI | InChI=1S/C15H19BrN4O/c16-12-4-5-15-11(7-12)8-14(21-15)10-20-9-13(18-19-20)3-1-2-6-17/h4-5,7,9,14H,1-3,6,8,10,17H2 |
| InChIKey | LDCONOMKPQJQQF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine?
The IUPAC name of 4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine (CID 104539127) is 4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine.
What is the SMILES notation for 4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine?
The canonical SMILES for 4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine is NCCCCc1cn(CC2Cc3cc(Br)ccc3O2)nn1.
What is the InChIKey of 4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine?
The InChIKey is LDCONOMKPQJQQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrN4O/c16-12-4-5-15-11(7-12)8-14(21-15)10-20-9-13(18-19-20)3-1-2-6-17/h4-5,7,9,14H,1-3,6,8,10,17H2.
What are the key properties of 4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine?
4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine has a molecular weight of 351.25 g/mol, XLogP of 2.33, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]butan-1-amine is sourced from PubChem (CID 104539127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).