C15H20N4O — CID 104539224
4-[1-(2,3-dihydro-1-benzofuran-2-ylmethyl)triazol-4-yl]butan-1-amine (PubChem CID 104539224) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-[1-(2,3-dihydro-1-benzofuran-2-ylmethyl)triazol-4-yl]butan-1-amine.
| Compound Name | 4-[1-(2,3-dihydro-1-benzofuran-2-ylmethyl)triazol-4-yl]butan-1-amine |
|---|---|
| PubChem CID | 104539224 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 4-[1-(2,3-dihydro-1-benzofuran-2-ylmethyl)triazol-4-yl]butan-1-amine |
| SMILES | NCCCCc1cn(CC2Cc3ccccc3O2)nn1 |
| InChI | InChI=1S/C15H20N4O/c16-8-4-3-6-13-10-19(18-17-13)11-14-9-12-5-1-2-7-15(12)20-14/h1-2,5,7,10,14H,3-4,6,8-9,11,16H2 |
| InChIKey | XBVROVDJPXCYQI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|