C14H26ClNO — CID 106838012
4-(1-chloroethyl)-1-[(5,5-dimethyloxolan-2-yl)methyl]piperidine (PubChem CID 106838012) has the molecular formula C14H26ClNO and a molecular weight of 259.82 g/mol. Its IUPAC name is 4-(1-chloroethyl)-1-[(5,5-dimethyloxolan-2-yl)methyl]piperidine.
| Compound Name | 4-(1-chloroethyl)-1-[(5,5-dimethyloxolan-2-yl)methyl]piperidine |
|---|---|
| PubChem CID | 106838012 |
| Molecular Formula | C14H26ClNO |
| Molecular Weight | 259.82 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 4-(1-chloroethyl)-1-[(5,5-dimethyloxolan-2-yl)methyl]piperidine |
| SMILES | CC(Cl)C1CCN(CC2CCC(C)(C)O2)CC1 |
| InChI | InChI=1S/C14H26ClNO/c1-11(15)12-5-8-16(9-6-12)10-13-4-7-14(2,3)17-13/h11-13H,4-10H2,1-3H3 |
| InChIKey | YFLIEBLNUYNGGG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.82 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|