C11H21NO2 — CID 130167785
4-[(5,5-dimethyloxolan-2-yl)methyl]morpholine (PubChem CID 130167785) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 4-[(5,5-dimethyloxolan-2-yl)methyl]morpholine.
| Compound Name | 4-[(5,5-dimethyloxolan-2-yl)methyl]morpholine |
|---|---|
| PubChem CID | 130167785 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 4-[(5,5-dimethyloxolan-2-yl)methyl]morpholine |
| SMILES | CC1(C)CCC(CN2CCOCC2)O1 |
| InChI | InChI=1S/C11H21NO2/c1-11(2)4-3-10(14-11)9-12-5-7-13-8-6-12/h10H,3-9H2,1-2H3 |
| InChIKey | UFJVHDUBHQWGKF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |