C14H24N2O3 — CID 104649853
1-(4-methoxybutyl)-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 104649853) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(4-methoxybutyl)-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-(4-methoxybutyl)-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 104649853 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-(4-methoxybutyl)-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCCCN1C(=O)NC(=O)C12CCC(C)CC2 |
| InChI | InChI=1S/C14H24N2O3/c1-11-5-7-14(8-6-11)12(17)15-13(18)16(14)9-3-4-10-19-2/h11H,3-10H2,1-2H3,(H,15,17,18) |
| InChIKey | BQPSGWBLEUXUTR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|