C13H25NO — CID 104650087
3-(4-methoxybutyl)-5,5-dimethylcyclohex-2-en-1-amine (PubChem CID 104650087) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 3-(4-methoxybutyl)-5,5-dimethylcyclohex-2-en-1-amine.
| Compound Name | 3-(4-methoxybutyl)-5,5-dimethylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 104650087 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 3-(4-methoxybutyl)-5,5-dimethylcyclohex-2-en-1-amine |
| SMILES | COCCCCC1=CC(N)CC(C)(C)C1 |
| InChI | InChI=1S/C13H25NO/c1-13(2)9-11(8-12(14)10-13)6-4-5-7-15-3/h8,12H,4-7,9-10,14H2,1-3H3 |
| InChIKey | QIFRCIVFOGMRJQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|