C15H28N2O3 — CID 104650381
6-tert-butyl-1-(4-methoxybutyl)-3,3-dimethylpiperazine-2,5-dione (PubChem CID 104650381) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is 6-tert-butyl-1-(4-methoxybutyl)-3,3-dimethylpiperazine-2,5-dione.
| Compound Name | 6-tert-butyl-1-(4-methoxybutyl)-3,3-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 104650381 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 6-tert-butyl-1-(4-methoxybutyl)-3,3-dimethylpiperazine-2,5-dione |
| SMILES | COCCCCN1C(=O)C(C)(C)NC(=O)C1C(C)(C)C |
| InChI | InChI=1S/C15H28N2O3/c1-14(2,3)11-12(18)16-15(4,5)13(19)17(11)9-7-8-10-20-6/h11H,7-10H2,1-6H3,(H,16,18) |
| InChIKey | YSQSYRXPJWUCSV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|