C15H26N2O2 — CID 107902088
6-tert-butyl-3,3-dimethyl-1-(3-methylbut-2-enyl)piperazine-2,5-dione (PubChem CID 107902088) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 6-tert-butyl-3,3-dimethyl-1-(3-methylbut-2-enyl)piperazine-2,5-dione.
| Compound Name | 6-tert-butyl-3,3-dimethyl-1-(3-methylbut-2-enyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 107902088 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 6-tert-butyl-3,3-dimethyl-1-(3-methylbut-2-enyl)piperazine-2,5-dione |
| SMILES | CC(C)=CCN1C(=O)C(C)(C)NC(=O)C1C(C)(C)C |
| InChI | InChI=1S/C15H26N2O2/c1-10(2)8-9-17-11(14(3,4)5)12(18)16-15(6,7)13(17)19/h8,11H,9H2,1-7H3,(H,16,18) |
| InChIKey | OUPAKWFOJYBCHV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|